C27H21Cl2N3O2 — CID 126237508
(5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126237508) has the molecular formula C27H21Cl2N3O2 and a molecular weight of 490.39 g/mol. Its IUPAC name is (5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126237508 |
| Molecular Formula | C27H21Cl2N3O2 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3cn(Cc4ccc(Cl)c(Cl)c4)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C27H21Cl2N3O2/c1-17-6-8-18(9-7-17)15-32-26(33)24(30-27(32)34)13-20-16-31(25-5-3-2-4-21(20)25)14-19-10-11-22(28)23(29)12-19/h2-13,16H,14-15H2,1H3,(H,30,34)/b24-13+ |
| InChIKey | BUWJHDHDUDKLDG-ZMOGYAJESA-N |
| XLogP | 6.40 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|