C28H23ClN4O3 — CID 3389847
2-[4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 3389847) has the molecular formula C28H23ClN4O3 and a molecular weight of 498.97 g/mol. Its IUPAC name is 2-[4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3389847 |
| Molecular Formula | C28H23ClN4O3 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-[4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)NC(=Cc3cn(Cc4ccc(Cl)cc4)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C28H23ClN4O3/c1-18-6-12-22(13-7-18)30-26(34)17-33-27(35)24(31-28(33)36)14-20-16-32(25-5-3-2-4-23(20)25)15-19-8-10-21(29)11-9-19/h2-14,16H,15,17H2,1H3,(H,30,34)(H,31,36) |
| InChIKey | KUWRLBKZYVXILI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|