C30H27N5O4 — CID 22306749
2-[3-[(Z)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 22306749) has the molecular formula C30H27N5O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is 2-[3-[(Z)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[3-[(Z)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 22306749 |
| Molecular Formula | C30H27N5O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 2-[3-[(Z)-[1-[2-(3-methylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C\c3cn(CC(=O)Nc4cccc(C)c4)c4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C30H27N5O4/c1-19-7-5-9-22(13-19)31-27(36)17-34-16-21(24-11-3-4-12-26(24)34)15-25-29(38)35(30(39)33-25)18-28(37)32-23-10-6-8-20(2)14-23/h3-16H,17-18H2,1-2H3,(H,31,36)(H,32,37)(H,33,39)/b25-15- |
| InChIKey | DVCJABSVOSOKLF-MYYYXRDXSA-N |
| XLogP | 4.43 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|