C24H22N4O5 — CID 126235514
2-[3-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid (PubChem CID 126235514) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[3-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 126235514 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[3-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cn(CC(=O)O)c3ccccc23)C1=O |
| InChI | InChI=1S/C24H22N4O5/c1-2-15-7-3-5-9-18(15)25-21(29)13-28-23(32)19(26-24(28)33)11-16-12-27(14-22(30)31)20-10-6-4-8-17(16)20/h3-12H,2,13-14H2,1H3,(H,25,29)(H,26,33)(H,30,31)/b19-11+ |
| InChIKey | NEIMWSAWXHRTJZ-YBFXNURJSA-N |
| XLogP | 2.82 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|