C24H22N4O3 — CID 3505703
2-[3-[(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 3505703) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[3-[(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3505703 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[3-[(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]indol-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | C=CCN1C(=O)NC(=Cc2cn(CC(=O)Nc3ccc(C)cc3)c3ccccc23)C1=O |
| InChI | InChI=1S/C24H22N4O3/c1-3-12-28-23(30)20(26-24(28)31)13-17-14-27(21-7-5-4-6-19(17)21)15-22(29)25-18-10-8-16(2)9-11-18/h3-11,13-14H,1,12,15H2,2H3,(H,25,29)(H,26,31) |
| InChIKey | NMFROTAIPGEGOH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|