C32H26N4O3 — CID 44713993
N-(3-methylphenyl)-2-[(4E)-4-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 44713993) has the molecular formula C32H26N4O3 and a molecular weight of 514.59 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[(4E)-4-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[(4E)-4-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 44713993 |
| Molecular Formula | C32H26N4O3 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-(3-methylphenyl)-2-[(4E)-4-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3cn(Cc4ccc5ccccc5c4)c4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C32H26N4O3/c1-21-7-6-10-26(15-21)33-30(37)20-36-31(38)28(34-32(36)39)17-25-19-35(29-12-5-4-11-27(25)29)18-22-13-14-23-8-2-3-9-24(23)16-22/h2-17,19H,18,20H2,1H3,(H,33,37)(H,34,39)/b28-17+ |
| InChIKey | AXXLTDYRJRWQPT-OGLMXYFKSA-N |
| XLogP | 5.68 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|