C29H26N4O3 — CID 126108279
2-[(4E)-4-[(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126108279) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[(4E)-4-[(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126108279 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[(4E)-4-[(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3cc(C)n(-c4ccc5ccccc5c4)c3C)C2=O)c1 |
| InChI | InChI=1S/C29H26N4O3/c1-18-7-6-10-24(13-18)30-27(34)17-32-28(35)26(31-29(32)36)16-23-14-19(2)33(20(23)3)25-12-11-21-8-4-5-9-22(21)15-25/h4-16H,17H2,1-3H3,(H,30,34)(H,31,36)/b26-16+ |
| InChIKey | ZIZCQKRQLNVPMX-WGOQTCKBSA-N |
| XLogP | 5.09 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|