C28H25N3O2 — CID 126235278
(5E)-3-[(4-methylphenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126235278) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (5E)-3-[(4-methylphenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-methylphenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126235278 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (5E)-3-[(4-methylphenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3cn(Cc4cccc(C)c4)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C28H25N3O2/c1-19-10-12-21(13-11-19)17-31-27(32)25(29-28(31)33)15-23-18-30(26-9-4-3-8-24(23)26)16-22-7-5-6-20(2)14-22/h3-15,18H,16-17H2,1-2H3,(H,29,33)/b25-15+ |
| InChIKey | JNJTZXHWLBRJSW-MFKUBSTISA-N |
| XLogP | 5.40 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|