C28H23N3O3 — CID 1329245
1-benzyl-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1329245) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-benzyl-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzyl-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1329245 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-benzyl-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cccc(Cn2cc(C=C3C(=O)NC(=O)N(Cc4ccccc4)C3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C28H23N3O3/c1-19-8-7-11-21(14-19)16-30-18-22(23-12-5-6-13-25(23)30)15-24-26(32)29-28(34)31(27(24)33)17-20-9-3-2-4-10-20/h2-15,18H,16-17H2,1H3,(H,29,32,34) |
| InChIKey | GHTZCVUOHVVIIZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|