C27H22FN3O2 — CID 1322775
3-[(4-fluorophenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 1322775) has the molecular formula C27H22FN3O2 and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 3-[(4-fluorophenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1322775 |
| Molecular Formula | C27H22FN3O2 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(Cn2cc(C=C3NC(=O)N(Cc4ccc(F)cc4)C3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C27H22FN3O2/c1-18-5-4-6-20(13-18)15-30-17-21(23-7-2-3-8-25(23)30)14-24-26(32)31(27(33)29-24)16-19-9-11-22(28)12-10-19/h2-14,17H,15-16H2,1H3,(H,29,33) |
| InChIKey | NFNYLBWXEVBDDE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|