C22H19Br2N3O6 — CID 126240571
2-[2,6-dibromo-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126240571) has the molecular formula C22H19Br2N3O6 and a molecular weight of 581.22 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126240571 |
| Molecular Formula | C22H19Br2N3O6 |
| Molecular Weight | 581.22 g/mol |
| Exact Mass | 578.96 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(Br)c(OCC(=O)O)c(Br)c2)C1=O |
| InChI | InChI=1S/C22H19Br2N3O6/c1-2-13-5-3-4-6-16(13)25-18(28)10-27-21(31)17(26-22(27)32)9-12-7-14(23)20(15(24)8-12)33-11-19(29)30/h3-9H,2,10-11H2,1H3,(H,25,28)(H,26,32)(H,29,30)/b17-9+ |
| InChIKey | WCUFAMDFKQFCOZ-RQZCQDPDSA-N |
| XLogP | 3.77 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|