C21H17BrIN3O7 — CID 126248177
2-[2-bromo-4-iodo-6-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126248177) has the molecular formula C21H17BrIN3O7 and a molecular weight of 630.19 g/mol. Its IUPAC name is 2-[2-bromo-4-iodo-6-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-iodo-6-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126248177 |
| Molecular Formula | C21H17BrIN3O7 |
| Molecular Weight | 630.19 g/mol |
| Exact Mass | 628.93 |
| IUPAC Name | 2-[2-bromo-4-iodo-6-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(I)cc(Br)c2OCC(=O)O)C1=O |
| InChI | InChI=1S/C21H17BrIN3O7/c1-32-16-5-3-2-4-14(16)24-17(27)9-26-20(30)15(25-21(26)31)7-11-6-12(23)8-13(22)19(11)33-10-18(28)29/h2-8H,9-10H2,1H3,(H,24,27)(H,25,31)(H,28,29)/b15-7+ |
| InChIKey | TWNNBCFZPLTOFX-VIZOYTHASA-N |
| XLogP | 3.06 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|