C27H21Br2Cl2N3O4 — CID 126239637
2-[(4E)-4-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 126239637) has the molecular formula C27H21Br2Cl2N3O4 and a molecular weight of 682.20 g/mol. Its IUPAC name is 2-[(4E)-4-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126239637 |
| Molecular Formula | C27H21Br2Cl2N3O4 |
| Molecular Weight | 682.20 g/mol |
| Exact Mass | 678.93 |
| IUPAC Name | 2-[(4E)-4-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(Br)c(OCc3ccc(Cl)c(Cl)c3)c(Br)c2)C1=O |
| InChI | InChI=1S/C27H21Br2Cl2N3O4/c1-2-17-5-3-4-6-22(17)32-24(35)13-34-26(36)23(33-27(34)37)12-16-9-18(28)25(19(29)10-16)38-14-15-7-8-20(30)21(31)11-15/h3-12H,2,13-14H2,1H3,(H,32,35)(H,33,37)/b23-12+ |
| InChIKey | SGNGDYXRFUWMPT-FSJBWODESA-N |
| XLogP | 7.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.20 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|