C27H23BrClN3O6 — CID 126248506
2-[(4Z)-4-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126248506) has the molecular formula C27H23BrClN3O6 and a molecular weight of 600.85 g/mol. Its IUPAC name is 2-[(4Z)-4-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126248506 |
| Molecular Formula | C27H23BrClN3O6 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 599.05 |
| IUPAC Name | 2-[(4Z)-4-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C\c2cc(Br)c(OCc3ccccc3Cl)c(OC)c2)C1=O |
| InChI | InChI=1S/C27H23BrClN3O6/c1-36-22-10-6-5-9-20(22)30-24(33)14-32-26(34)21(31-27(32)35)12-16-11-18(28)25(23(13-16)37-2)38-15-17-7-3-4-8-19(17)29/h3-13H,14-15H2,1-2H3,(H,30,33)(H,31,35)/b21-12- |
| InChIKey | QOSVWHCRDRDUEO-MTJSOVHGSA-N |
| XLogP | 5.23 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|