C27H21BrCl2FN3O5 — CID 126218938
2-[(4E)-4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126218938) has the molecular formula C27H21BrCl2FN3O5 and a molecular weight of 637.29 g/mol. Its IUPAC name is 2-[(4E)-4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126218938 |
| Molecular Formula | C27H21BrCl2FN3O5 |
| Molecular Weight | 637.29 g/mol |
| Exact Mass | 635.00 |
| IUPAC Name | 2-[(4E)-4-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H21BrCl2FN3O5/c1-2-38-23-11-15(9-18(28)25(23)39-14-16-7-8-17(29)12-19(16)30)10-22-26(36)34(27(37)33-22)13-24(35)32-21-6-4-3-5-20(21)31/h3-12H,2,13-14H2,1H3,(H,32,35)(H,33,37)/b22-10+ |
| InChIKey | QCFFKCTXWLPGPR-LSHDLFTRSA-N |
| XLogP | 6.40 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.29 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|