C31H25BrFN3O5 — CID 126210144
2-[(4E)-4-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126210144) has the molecular formula C31H25BrFN3O5 and a molecular weight of 618.46 g/mol. Its IUPAC name is 2-[(4E)-4-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126210144 |
| Molecular Formula | C31H25BrFN3O5 |
| Molecular Weight | 618.46 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | 2-[(4E)-4-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H25BrFN3O5/c1-2-40-27-16-19(14-23(32)29(27)41-18-21-10-7-9-20-8-3-4-11-22(20)21)15-26-30(38)36(31(39)35-26)17-28(37)34-25-13-6-5-12-24(25)33/h3-16H,2,17-18H2,1H3,(H,34,37)(H,35,39)/b26-15+ |
| InChIKey | ZCUYPOPRAHWHJM-CVKSISIWSA-N |
| XLogP | 6.25 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|