C25H18Br2FN3O4 — CID 126215755
2-[(4E)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126215755) has the molecular formula C25H18Br2FN3O4 and a molecular weight of 603.24 g/mol. Its IUPAC name is 2-[(4E)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126215755 |
| Molecular Formula | C25H18Br2FN3O4 |
| Molecular Weight | 603.24 g/mol |
| Exact Mass | 600.96 |
| IUPAC Name | 2-[(4E)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C/c2cc(Br)c(OCc3ccccc3)c(Br)c2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C25H18Br2FN3O4/c26-17-10-16(11-18(27)23(17)35-14-15-6-2-1-3-7-15)12-21-24(33)31(25(34)30-21)13-22(32)29-20-9-5-4-8-19(20)28/h1-12H,13-14H2,(H,29,32)(H,30,34)/b21-12+ |
| InChIKey | CIHFSGNWIDLJPN-CIAFOILYSA-N |
| XLogP | 5.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.24 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|