C26H19BrFN3O6 — CID 126219951
4-[[2-bromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126219951) has the molecular formula C26H19BrFN3O6 and a molecular weight of 568.36 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126219951 |
| Molecular Formula | C26H19BrFN3O6 |
| Molecular Weight | 568.36 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(CN1C(=O)N/C(=C/c2ccc(OCc3ccc(C(=O)O)cc3)c(Br)c2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C26H19BrFN3O6/c27-18-11-16(7-10-22(18)37-14-15-5-8-17(9-6-15)25(34)35)12-21-24(33)31(26(36)30-21)13-23(32)29-20-4-2-1-3-19(20)28/h1-12H,13-14H2,(H,29,32)(H,30,36)(H,34,35)/b21-12+ |
| InChIKey | SXLSYCRQWSJTKQ-CIAFOILYSA-N |
| XLogP | 4.40 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|