C29H21FIN3O4 — CID 126217340
N-(2-fluorophenyl)-2-[(4E)-4-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126217340) has the molecular formula C29H21FIN3O4 and a molecular weight of 621.41 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(4E)-4-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(4E)-4-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126217340 |
| Molecular Formula | C29H21FIN3O4 |
| Molecular Weight | 621.41 g/mol |
| Exact Mass | 621.06 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(4E)-4-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C/c2ccc(OCc3ccc4ccccc4c3)c(I)c2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C29H21FIN3O4/c30-22-7-3-4-8-24(22)32-27(35)16-34-28(36)25(33-29(34)37)15-18-10-12-26(23(31)14-18)38-17-19-9-11-20-5-1-2-6-21(20)13-19/h1-15H,16-17H2,(H,32,35)(H,33,37)/b25-15+ |
| InChIKey | IBJAIWIGPPCBDJ-MFKUBSTISA-N |
| XLogP | 5.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|