C26H21FIN3O5 — CID 126220795
N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126220795) has the molecular formula C26H21FIN3O5 and a molecular weight of 601.37 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126220795 |
| Molecular Formula | C26H21FIN3O5 |
| Molecular Weight | 601.37 g/mol |
| Exact Mass | 601.05 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)ccc1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C26H21FIN3O5/c1-35-23-13-17(8-11-22(23)36-15-16-6-9-18(28)10-7-16)12-21-25(33)31(26(34)30-21)14-24(32)29-20-5-3-2-4-19(20)27/h2-13H,14-15H2,1H3,(H,29,32)(H,30,34)/b21-12+ |
| InChIKey | YJNMQBAACQUYNG-CIAFOILYSA-N |
| XLogP | 4.55 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|