C25H17F2I2N3O4 — CID 126218964
N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126218964) has the molecular formula C25H17F2I2N3O4 and a molecular weight of 715.23 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126218964 |
| Molecular Formula | C25H17F2I2N3O4 |
| Molecular Weight | 715.23 g/mol |
| Exact Mass | 714.93 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C/c2cc(I)c(OCc3ccc(F)cc3)c(I)c2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C25H17F2I2N3O4/c26-16-7-5-14(6-8-16)13-36-23-18(28)9-15(10-19(23)29)11-21-24(34)32(25(35)31-21)12-22(33)30-20-4-2-1-3-17(20)27/h1-11H,12-13H2,(H,30,33)(H,31,35)/b21-11+ |
| InChIKey | QVLLDFWCMCBFOT-SRZZPIQSSA-N |
| XLogP | 5.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.23 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|