C31H26BrN3O4 — CID 126246042
2-[(4E)-4-[[5-bromo-2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 126246042) has the molecular formula C31H26BrN3O4 and a molecular weight of 584.47 g/mol. Its IUPAC name is 2-[(4E)-4-[[5-bromo-2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[5-bromo-2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126246042 |
| Molecular Formula | C31H26BrN3O4 |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | 2-[(4E)-4-[[5-bromo-2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(Br)ccc2OCc2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C31H26BrN3O4/c1-2-21-7-5-6-10-26(21)33-29(36)18-35-30(37)27(34-31(35)38)17-24-16-25(32)13-14-28(24)39-19-20-11-12-22-8-3-4-9-23(22)15-20/h3-17H,2,18-19H2,1H3,(H,33,36)(H,34,38)/b27-17+ |
| InChIKey | RBJIAAHMOFMTHL-WPWMEQJKSA-N |
| XLogP | 6.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|