C32H27N3O6 — CID 126252287
4-[[1-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid (PubChem CID 126252287) has the molecular formula C32H27N3O6 and a molecular weight of 549.58 g/mol. Its IUPAC name is 4-[[1-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid.
| Compound Name | 4-[[1-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 126252287 |
| Molecular Formula | C32H27N3O6 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 4-[[1-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2c(OCc3ccc(C(=O)O)cc3)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C32H27N3O6/c1-2-21-7-4-6-10-26(21)33-29(36)18-35-30(37)27(34-32(35)40)17-25-24-9-5-3-8-22(24)15-16-28(25)41-19-20-11-13-23(14-12-20)31(38)39/h3-17H,2,18-19H2,1H3,(H,33,36)(H,34,40)(H,38,39)/b27-17+ |
| InChIKey | FAOAUCXIKCWIRE-WPWMEQJKSA-N |
| XLogP | 5.21 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|