C27H24IN3O4 — CID 126244386
N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126244386) has the molecular formula C27H24IN3O4 and a molecular weight of 581.41 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126244386 |
| Molecular Formula | C27H24IN3O4 |
| Molecular Weight | 581.41 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2ccc(OCc3ccc(I)cc3)cc2)C1=O |
| InChI | InChI=1S/C27H24IN3O4/c1-2-20-5-3-4-6-23(20)29-25(32)16-31-26(33)24(30-27(31)34)15-18-9-13-22(14-10-18)35-17-19-7-11-21(28)12-8-19/h3-15H,2,16-17H2,1H3,(H,29,32)(H,30,34)/b24-15+ |
| InChIKey | MAPWXSZBQQRHCN-BUVRLJJBSA-N |
| XLogP | 4.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|