C28H27N3O4 — CID 126236656
N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126236656) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126236656 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-(2-ethylphenyl)-2-[(4E)-4-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2ccc(OCc3cccc(C)c3)cc2)C1=O |
| InChI | InChI=1S/C28H27N3O4/c1-3-22-9-4-5-10-24(22)29-26(32)17-31-27(33)25(30-28(31)34)16-20-11-13-23(14-12-20)35-18-21-8-6-7-19(2)15-21/h4-16H,3,17-18H2,1-2H3,(H,29,32)(H,30,34)/b25-16+ |
| InChIKey | DRPZSIORGUOXMH-PCLIKHOPSA-N |
| XLogP | 4.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|