C30H28ClN3O7 — CID 126244736
3-[[2-chloro-6-ethoxy-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126244736) has the molecular formula C30H28ClN3O7 and a molecular weight of 578.02 g/mol. Its IUPAC name is 3-[[2-chloro-6-ethoxy-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-6-ethoxy-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126244736 |
| Molecular Formula | C30H28ClN3O7 |
| Molecular Weight | 578.02 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | 3-[[2-chloro-6-ethoxy-4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3CC)C2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C30H28ClN3O7/c1-3-20-9-5-6-11-23(20)32-26(35)16-34-28(36)24(33-30(34)39)14-19-13-22(31)27(25(15-19)40-4-2)41-17-18-8-7-10-21(12-18)29(37)38/h5-15H,3-4,16-17H2,1-2H3,(H,32,35)(H,33,39)(H,37,38)/b24-14+ |
| InChIKey | AVSYZJCJONEKFJ-ZVHZXABRSA-N |
| XLogP | 5.11 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.02 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|