C27H21ClFN3O7 — CID 126208582
3-[[2-chloro-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126208582) has the molecular formula C27H21ClFN3O7 and a molecular weight of 553.93 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126208582 |
| Molecular Formula | C27H21ClFN3O7 |
| Molecular Weight | 553.93 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 3-[[2-chloro-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H21ClFN3O7/c1-38-22-12-16(10-18(28)24(22)39-14-15-5-4-6-17(9-15)26(35)36)11-21-25(34)32(27(37)31-21)13-23(33)30-20-8-3-2-7-19(20)29/h2-12H,13-14H2,1H3,(H,30,33)(H,31,37)(H,35,36)/b21-11+ |
| InChIKey | RYUZVEOOXASCFM-SRZZPIQSSA-N |
| XLogP | 4.30 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|