C29H24Cl2FN3O5 — CID 126207001
2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126207001) has the molecular formula C29H24Cl2FN3O5 and a molecular weight of 584.43 g/mol. Its IUPAC name is 2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126207001 |
| Molecular Formula | C29H24Cl2FN3O5 |
| Molecular Weight | 584.43 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | 2-[(4E)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | C=CCc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H24Cl2FN3O5/c1-3-6-18-11-17(13-25(39-2)27(18)40-16-19-9-10-20(30)14-21(19)31)12-24-28(37)35(29(38)34-24)15-26(36)33-23-8-5-4-7-22(23)32/h3-5,7-14H,1,6,15-16H2,2H3,(H,33,36)(H,34,38)/b24-12+ |
| InChIKey | JIWRAKZCAYJHQN-WYMPLXKRSA-N |
| XLogP | 5.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.43 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|