C28H24Cl2N2O7 — CID 126405445
methyl 5-[[(4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126405445) has the molecular formula C28H24Cl2N2O7 and a molecular weight of 571.41 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126405445 |
| Molecular Formula | C28H24Cl2N2O7 |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | C=CCc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H24Cl2N2O7/c1-4-5-17-10-16(12-24(36-2)25(17)38-15-18-6-7-19(29)13-21(18)30)11-22-26(33)32(28(35)31-22)14-20-8-9-23(39-20)27(34)37-3/h4,6-13H,1,5,14-15H2,2-3H3,(H,31,35)/b22-11- |
| InChIKey | VAGBAQSGFXWATG-JJFYIABZSA-N |
| XLogP | 5.78 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|