C29H26Cl2N2O7 — CID 126403204
methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126403204) has the molecular formula C29H26Cl2N2O7 and a molecular weight of 585.44 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126403204 |
| Molecular Formula | C29H26Cl2N2O7 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | C=CCc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc(OCC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H26Cl2N2O7/c1-4-6-19-11-18(14-25(38-5-2)26(19)39-16-17-7-9-21(30)22(31)12-17)13-23-27(34)33(29(36)32-23)15-20-8-10-24(40-20)28(35)37-3/h4,7-14H,1,5-6,15-16H2,2-3H3,(H,32,36)/b23-13- |
| InChIKey | FQHVMDODKNXVMQ-QRVIBDJDSA-N |
| XLogP | 6.17 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|