C26H28N2O9 — CID 126402598
methyl 5-[[(4Z)-4-[[3-ethoxy-4-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126402598) has the molecular formula C26H28N2O9 and a molecular weight of 512.52 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-ethoxy-4-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-ethoxy-4-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126402598 |
| Molecular Formula | C26H28N2O9 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-ethoxy-4-[(2S)-1-methoxy-1-oxopropan-2-yl]oxy-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | C=CCc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc(OCC)c1O[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C26H28N2O9/c1-6-8-17-11-16(13-21(35-7-2)22(17)36-15(3)24(30)33-4)12-19-23(29)28(26(32)27-19)14-18-9-10-20(37-18)25(31)34-5/h6,9-13,15H,1,7-8,14H2,2-5H3,(H,27,32)/b19-12-/t15-/m0/s1 |
| InChIKey | BNOZVYAPLQHSGI-CCRNYGKSSA-N |
| XLogP | 3.23 |
| TPSA | 133.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|