C23H26N2O7 — CID 124549396
methyl 5-[[(4Z)-4-[[4-[(2R)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 124549396) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-[(2R)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-[(2R)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 124549396 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-[(2R)-butan-2-yl]oxy-3-ethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)ccc1O[C@H](C)CC |
| InChI | InChI=1S/C23H26N2O7/c1-5-14(3)31-18-9-7-15(12-20(18)30-6-2)11-17-21(26)25(23(28)24-17)13-16-8-10-19(32-16)22(27)29-4/h7-12,14H,5-6,13H2,1-4H3,(H,24,28)/b17-11-/t14-/m1/s1 |
| InChIKey | UTEVYQZJQHSWQI-RQNDZEIBSA-N |
| XLogP | 3.74 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|