C20H18N2O8 — CID 4534007
2-[3-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 4534007) has the molecular formula C20H18N2O8 and a molecular weight of 414.37 g/mol. Its IUPAC name is 2-[3-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[3-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 4534007 |
| Molecular Formula | C20H18N2O8 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[3-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3cccc(OC(C)C(=O)O)c3)C2=O)o1 |
| InChI | InChI=1S/C20H18N2O8/c1-11(18(24)25)29-13-5-3-4-12(8-13)9-15-17(23)22(20(27)21-15)10-14-6-7-16(30-14)19(26)28-2/h3-9,11H,10H2,1-2H3,(H,21,27)(H,24,25) |
| InChIKey | BKAMRSGTCNSRJP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|