C24H20N2O8 — CID 4008482
2-[1-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxypropanoic acid (PubChem CID 4008482) has the molecular formula C24H20N2O8 and a molecular weight of 464.43 g/mol. Its IUPAC name is 2-[1-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxypropanoic acid.
| Compound Name | 2-[1-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 4008482 |
| Molecular Formula | C24H20N2O8 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-[1-[[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]naphthalen-2-yl]oxypropanoic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3c(OC(C)C(=O)O)ccc4ccccc34)C2=O)o1 |
| InChI | InChI=1S/C24H20N2O8/c1-13(22(28)29)33-19-9-7-14-5-3-4-6-16(14)17(19)11-18-21(27)26(24(31)25-18)12-15-8-10-20(34-15)23(30)32-2/h3-11,13H,12H2,1-2H3,(H,25,31)(H,28,29) |
| InChIKey | BNDIEKGETYMBFF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|