C21H19ClN2O8 — CID 4046421
methyl 5-[[4-[[5-chloro-2-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 4046421) has the molecular formula C21H19ClN2O8 and a molecular weight of 462.84 g/mol. Its IUPAC name is methyl 5-[[4-[[5-chloro-2-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[5-chloro-2-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4046421 |
| Molecular Formula | C21H19ClN2O8 |
| Molecular Weight | 462.84 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | methyl 5-[[4-[[5-chloro-2-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3cc(Cl)ccc3OC(C)C(=O)OC)C2=O)o1 |
| InChI | InChI=1S/C21H19ClN2O8/c1-11(19(26)29-2)31-16-6-4-13(22)8-12(16)9-15-18(25)24(21(28)23-15)10-14-5-7-17(32-14)20(27)30-3/h4-9,11H,10H2,1-3H3,(H,23,28) |
| InChIKey | YBISVQXTLZKXDZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|