C24H16BrClN2O7 — CID 126415048
methyl 5-[[(4Z)-4-[[2-(4-bromobenzoyl)oxy-5-chlorophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126415048) has the molecular formula C24H16BrClN2O7 and a molecular weight of 559.76 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-(4-bromobenzoyl)oxy-5-chlorophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-(4-bromobenzoyl)oxy-5-chlorophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126415048 |
| Molecular Formula | C24H16BrClN2O7 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 557.98 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-(4-bromobenzoyl)oxy-5-chlorophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Cl)ccc3OC(=O)c3ccc(Br)cc3)C2=O)o1 |
| InChI | InChI=1S/C24H16BrClN2O7/c1-33-23(31)20-9-7-17(34-20)12-28-21(29)18(27-24(28)32)11-14-10-16(26)6-8-19(14)35-22(30)13-2-4-15(25)5-3-13/h2-11H,12H2,1H3,(H,27,32)/b18-11- |
| InChIKey | ZYLQBXCPSSCRAW-WQRHYEAKSA-N |
| XLogP | 4.79 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|