C25H19ClN2O8 — CID 126405236
3-[[4-chloro-2-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126405236) has the molecular formula C25H19ClN2O8 and a molecular weight of 510.89 g/mol. Its IUPAC name is 3-[[4-chloro-2-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-chloro-2-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126405236 |
| Molecular Formula | C25H19ClN2O8 |
| Molecular Weight | 510.89 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 3-[[4-chloro-2-[(Z)-[1-[(5-methoxycarbonylfuran-2-yl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Cl)ccc3OCc3cccc(C(=O)O)c3)C2=O)o1 |
| InChI | InChI=1S/C25H19ClN2O8/c1-34-24(32)21-8-6-18(36-21)12-28-22(29)19(27-25(28)33)11-16-10-17(26)5-7-20(16)35-13-14-3-2-4-15(9-14)23(30)31/h2-11H,12-13H2,1H3,(H,27,33)(H,30,31)/b19-11- |
| InChIKey | QEXUXXGUROFQKJ-ODLFYWEKSA-N |
| XLogP | 4.09 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|