C25H21N3O8 — CID 5137551
methyl 5-[[4-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 5137551) has the molecular formula C25H21N3O8 and a molecular weight of 491.46 g/mol. Its IUPAC name is methyl 5-[[4-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 5137551 |
| Molecular Formula | C25H21N3O8 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | methyl 5-[[4-[[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3cc([N+](=O)[O-])ccc3OCc3cccc(C)c3)C2=O)o1 |
| InChI | InChI=1S/C25H21N3O8/c1-15-4-3-5-16(10-15)14-35-21-8-6-18(28(32)33)11-17(21)12-20-23(29)27(25(31)26-20)13-19-7-9-22(36-19)24(30)34-2/h3-12H,13-14H2,1-2H3,(H,26,31) |
| InChIKey | HNYCFLUIIVGPHJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|