C26H18N4O11 — CID 126412637
methyl 5-[[(4Z)-4-[[5-nitro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126412637) has the molecular formula C26H18N4O11 and a molecular weight of 562.45 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[5-nitro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[5-nitro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126412637 |
| Molecular Formula | C26H18N4O11 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[5-nitro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc([N+](=O)[O-])ccc3OC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)C2=O)o1 |
| InChI | InChI=1S/C26H18N4O11/c1-39-25(33)22-10-8-19(40-22)14-28-24(32)20(27-26(28)34)13-16-12-18(30(37)38)7-9-21(16)41-23(31)11-4-15-2-5-17(6-3-15)29(35)36/h2-13H,14H2,1H3,(H,27,34)/b11-4+,20-13- |
| InChIKey | JUXIJWILUCGAKN-NSMVQRMQSA-N |
| XLogP | 3.59 |
| TPSA | 201.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|