C27H21N3O10 — CID 126411868
methyl 5-[[(4Z)-4-[[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126411868) has the molecular formula C27H21N3O10 and a molecular weight of 547.48 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126411868 |
| Molecular Formula | C27H21N3O10 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cccc([N+](=O)[O-])c3OC(=O)/C=C/c3ccc(OC)cc3)C2=O)o1 |
| InChI | InChI=1S/C27H21N3O10/c1-37-18-9-6-16(7-10-18)8-13-23(31)40-24-17(4-3-5-21(24)30(35)36)14-20-25(32)29(27(34)28-20)15-19-11-12-22(39-19)26(33)38-2/h3-14H,15H2,1-2H3,(H,28,34)/b13-8+,20-14- |
| InChIKey | GDJCJKZIDSQQBX-OILIPECNSA-N |
| XLogP | 3.69 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|