C28H21N3O8 — CID 126404499
methyl 5-[[(4Z)-4-[[4-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404499) has the molecular formula C28H21N3O8 and a molecular weight of 527.49 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404499 |
| Molecular Formula | C28H21N3O8 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-(naphthalen-1-ylmethoxy)-3-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3ccc(OCc4cccc5ccccc45)c([N+](=O)[O-])c3)C2=O)o1 |
| InChI | InChI=1S/C28H21N3O8/c1-37-27(33)25-12-10-20(39-25)15-30-26(32)22(29-28(30)34)13-17-9-11-24(23(14-17)31(35)36)38-16-19-7-4-6-18-5-2-3-8-21(18)19/h2-14H,15-16H2,1H3,(H,29,34)/b22-13- |
| InChIKey | MHKTWJNTMAAUKX-XKZIYDEJSA-N |
| XLogP | 4.80 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|