C26H22ClN3O9 — CID 126404509
methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404509) has the molecular formula C26H22ClN3O9 and a molecular weight of 555.93 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404509 |
| Molecular Formula | C26H22ClN3O9 |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc([N+](=O)[O-])c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H22ClN3O9/c1-3-37-22-12-15(11-20(30(34)35)23(22)38-14-16-6-4-5-7-18(16)27)10-19-24(31)29(26(33)28-19)13-17-8-9-21(39-17)25(32)36-2/h4-12H,3,13-14H2,1-2H3,(H,28,33)/b19-10- |
| InChIKey | MKOZDGNSQVFYNO-GRSHGNNSSA-N |
| XLogP | 4.70 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|