C25H26N4O11 — CID 126403313
methyl 5-[[(4Z)-4-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126403313) has the molecular formula C25H26N4O11 and a molecular weight of 558.50 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126403313 |
| Molecular Formula | C25H26N4O11 |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc([N+](=O)[O-])c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H26N4O11/c1-3-38-20-12-15(11-18(29(34)35)22(20)39-14-21(30)27-6-8-37-9-7-27)10-17-23(31)28(25(33)26-17)13-16-4-5-19(40-16)24(32)36-2/h4-5,10-12H,3,6-9,13-14H2,1-2H3,(H,26,33)/b17-10- |
| InChIKey | GMGNIGZMKVUGRB-YVLHZVERSA-N |
| XLogP | 1.70 |
| TPSA | 179.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|