C25H20ClN3O9 — CID 126407795
methyl 5-[[(4Z)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126407795) has the molecular formula C25H20ClN3O9 and a molecular weight of 541.90 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126407795 |
| Molecular Formula | C25H20ClN3O9 |
| Molecular Weight | 541.90 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(OC)c(OCc4ccc(Cl)cc4)c([N+](=O)[O-])c3)C2=O)o1 |
| InChI | InChI=1S/C25H20ClN3O9/c1-35-21-11-15(10-19(29(33)34)22(21)37-13-14-3-5-16(26)6-4-14)9-18-23(30)28(25(32)27-18)12-17-7-8-20(38-17)24(31)36-2/h3-11H,12-13H2,1-2H3,(H,27,32)/b18-9- |
| InChIKey | ZLURISRTOWYONX-NVMNQCDNSA-N |
| XLogP | 4.31 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.90 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|