C24H18ClN3O8 — CID 126402862
methyl 5-[[(4Z)-4-[(5-chloro-3-nitro-2-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126402862) has the molecular formula C24H18ClN3O8 and a molecular weight of 511.87 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(5-chloro-3-nitro-2-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(5-chloro-3-nitro-2-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126402862 |
| Molecular Formula | C24H18ClN3O8 |
| Molecular Weight | 511.87 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(5-chloro-3-nitro-2-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Cl)cc([N+](=O)[O-])c3OCc3ccccc3)C2=O)o1 |
| InChI | InChI=1S/C24H18ClN3O8/c1-34-23(30)20-8-7-17(36-20)12-27-22(29)18(26-24(27)31)10-15-9-16(25)11-19(28(32)33)21(15)35-13-14-5-3-2-4-6-14/h2-11H,12-13H2,1H3,(H,26,31)/b18-10- |
| InChIKey | CUMVBBAKZLFTFV-ZDLGFXPLSA-N |
| XLogP | 4.30 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|