C24H18Br2N2O6 — CID 126405924
methyl 5-[[(4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126405924) has the molecular formula C24H18Br2N2O6 and a molecular weight of 590.22 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126405924 |
| Molecular Formula | C24H18Br2N2O6 |
| Molecular Weight | 590.22 g/mol |
| Exact Mass | 587.95 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)c(OCc4ccccc4)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C24H18Br2N2O6/c1-32-23(30)20-8-7-16(34-20)12-28-22(29)19(27-24(28)31)11-15-9-17(25)21(18(26)10-15)33-13-14-5-3-2-4-6-14/h2-11H,12-13H2,1H3,(H,27,31)/b19-11- |
| InChIKey | SYOHBSCCODVROF-ODLFYWEKSA-N |
| XLogP | 5.26 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|