C24H17Br2FN2O6 — CID 126402592
methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126402592) has the molecular formula C24H17Br2FN2O6 and a molecular weight of 608.21 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126402592 |
| Molecular Formula | C24H17Br2FN2O6 |
| Molecular Weight | 608.21 g/mol |
| Exact Mass | 605.94 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)c(OCc4ccc(F)cc4)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C24H17Br2FN2O6/c1-33-23(31)20-7-6-16(35-20)11-29-22(30)19(28-24(29)32)10-14-8-17(25)21(18(26)9-14)34-12-13-2-4-15(27)5-3-13/h2-10H,11-12H2,1H3,(H,28,32)/b19-10- |
| InChIKey | BKYVRWVZOBMCKT-GRSHGNNSSA-N |
| XLogP | 5.40 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.21 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|