C19H14Br2N2O7 — CID 126405793
methyl 5-[[(4Z)-4-[(4-acetyloxy-3,5-dibromophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126405793) has the molecular formula C19H14Br2N2O7 and a molecular weight of 542.14 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(4-acetyloxy-3,5-dibromophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(4-acetyloxy-3,5-dibromophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126405793 |
| Molecular Formula | C19H14Br2N2O7 |
| Molecular Weight | 542.14 g/mol |
| Exact Mass | 539.92 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(4-acetyloxy-3,5-dibromophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Br)c(OC(C)=O)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C19H14Br2N2O7/c1-9(24)29-16-12(20)5-10(6-13(16)21)7-14-17(25)23(19(27)22-14)8-11-3-4-15(30-11)18(26)28-2/h3-7H,8H2,1-2H3,(H,22,27)/b14-7- |
| InChIKey | RVNPXTJRCLBKMR-AUWJEWJLSA-N |
| XLogP | 3.61 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|