C18H14I2N2O6 — CID 126407836
methyl 5-[[(4Z)-4-[(3,5-diiodo-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126407836) has the molecular formula C18H14I2N2O6 and a molecular weight of 608.13 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(3,5-diiodo-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(3,5-diiodo-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126407836 |
| Molecular Formula | C18H14I2N2O6 |
| Molecular Weight | 608.13 g/mol |
| Exact Mass | 607.89 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(3,5-diiodo-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(I)c(OC)c(I)c3)C2=O)o1 |
| InChI | InChI=1S/C18H14I2N2O6/c1-26-15-11(19)5-9(6-12(15)20)7-13-16(23)22(18(25)21-13)8-10-3-4-14(28-10)17(24)27-2/h3-7H,8H2,1-2H3,(H,21,25)/b13-7- |
| InChIKey | ZVTAOZJZUHOMMM-QPEQYQDCSA-N |
| XLogP | 3.38 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|