C22H23IN2O7 — CID 126404830
methyl 5-[[(4Z)-4-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404830) has the molecular formula C22H23IN2O7 and a molecular weight of 554.34 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404830 |
| Molecular Formula | C22H23IN2O7 |
| Molecular Weight | 554.34 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | methyl 5-[[(4Z)-4-[(3-ethoxy-5-iodo-4-propan-2-yloxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc(I)c1OC(C)C |
| InChI | InChI=1S/C22H23IN2O7/c1-5-30-18-10-13(8-15(23)19(18)31-12(2)3)9-16-20(26)25(22(28)24-16)11-14-6-7-17(32-14)21(27)29-4/h6-10,12H,5,11H2,1-4H3,(H,24,28)/b16-9- |
| InChIKey | NRIRXIJVYGFMTR-SXGWCWSVSA-N |
| XLogP | 3.95 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|